C19H32N4O3 — CID 167881803
2-amino-N-(3,5-diethoxyphenyl)-4-(4-methylpiperazin-1-yl)butanamide (PubChem CID 167881803) has the molecular formula C19H32N4O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-amino-N-(3,5-diethoxyphenyl)-4-(4-methylpiperazin-1-yl)butanamide.
| Compound Name | 2-amino-N-(3,5-diethoxyphenyl)-4-(4-methylpiperazin-1-yl)butanamide |
|---|---|
| PubChem CID | 167881803 |
| Molecular Formula | C19H32N4O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 2-amino-N-(3,5-diethoxyphenyl)-4-(4-methylpiperazin-1-yl)butanamide |
| SMILES | CCOc1cc(NC(=O)C(N)CCN2CCN(C)CC2)cc(OCC)c1 |
| InChI | InChI=1S/C19H32N4O3/c1-4-25-16-12-15(13-17(14-16)26-5-2)21-19(24)18(20)6-7-23-10-8-22(3)9-11-23/h12-14,18H,4-11,20H2,1-3H3,(H,21,24) |
| InChIKey | FGNDKPSRLHIJPH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |