C19H18ClN5O2 — CID 167882234
6-(3-chlorophenyl)-3-[3-(triazol-1-ylmethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one (PubChem CID 167882234) has the molecular formula C19H18ClN5O2 and a molecular weight of 383.84 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-3-[3-(triazol-1-ylmethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 6-(3-chlorophenyl)-3-[3-(triazol-1-ylmethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 167882234 |
| Molecular Formula | C19H18ClN5O2 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 6-(3-chlorophenyl)-3-[3-(triazol-1-ylmethyl)pyrrolidine-1-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1ccc(-c2cccc(Cl)c2)[nH]c1=O)N1CCC(Cn2ccnn2)C1 |
| InChI | InChI=1S/C19H18ClN5O2/c20-15-3-1-2-14(10-15)17-5-4-16(18(26)22-17)19(27)24-8-6-13(11-24)12-25-9-7-21-23-25/h1-5,7,9-10,13H,6,8,11-12H2,(H,22,26) |
| InChIKey | WHFKMOWSRRODFQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |