C19H21ClN2O5S — CID 167882502
3-(4-chlorophenyl)-3-[[4-[2-(methanesulfonamido)ethyl]benzoyl]amino]propanoic acid (PubChem CID 167882502) has the molecular formula C19H21ClN2O5S and a molecular weight of 424.91 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-[[4-[2-(methanesulfonamido)ethyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-3-[[4-[2-(methanesulfonamido)ethyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 167882502 |
| Molecular Formula | C19H21ClN2O5S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 3-(4-chlorophenyl)-3-[[4-[2-(methanesulfonamido)ethyl]benzoyl]amino]propanoic acid |
| SMILES | CS(=O)(=O)NCCc1ccc(C(=O)NC(CC(=O)O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H21ClN2O5S/c1-28(26,27)21-11-10-13-2-4-15(5-3-13)19(25)22-17(12-18(23)24)14-6-8-16(20)9-7-14/h2-9,17,21H,10-12H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | QUWUZLKXAUMCQI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |