C18H24N2O4S — CID 167882848
5-oxo-6-[[4-(thiomorpholin-4-ylmethyl)benzoyl]amino]hexanoic acid (PubChem CID 167882848) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 5-oxo-6-[[4-(thiomorpholin-4-ylmethyl)benzoyl]amino]hexanoic acid.
| Compound Name | 5-oxo-6-[[4-(thiomorpholin-4-ylmethyl)benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 167882848 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 5-oxo-6-[[4-(thiomorpholin-4-ylmethyl)benzoyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCC(=O)CNC(=O)c1ccc(CN2CCSCC2)cc1 |
| InChI | InChI=1S/C18H24N2O4S/c21-16(2-1-3-17(22)23)12-19-18(24)15-6-4-14(5-7-15)13-20-8-10-25-11-9-20/h4-7H,1-3,8-13H2,(H,19,24)(H,22,23) |
| InChIKey | BDNORDDFWFDQND-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |