C21H37NO2S — CID 167882856
N-(2,2-dicyclopentylethyl)spiro[4.4]nonane-3-sulfonamide (PubChem CID 167882856) has the molecular formula C21H37NO2S and a molecular weight of 367.60 g/mol. Its IUPAC name is N-(2,2-dicyclopentylethyl)spiro[4.4]nonane-3-sulfonamide.
| Compound Name | N-(2,2-dicyclopentylethyl)spiro[4.4]nonane-3-sulfonamide |
|---|---|
| PubChem CID | 167882856 |
| Molecular Formula | C21H37NO2S |
| Molecular Weight | 367.60 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | N-(2,2-dicyclopentylethyl)spiro[4.4]nonane-3-sulfonamide |
| SMILES | O=S(=O)(NCC(C1CCCC1)C1CCCC1)C1CCC2(CCCC2)C1 |
| InChI | InChI=1S/C21H37NO2S/c23-25(24,19-11-14-21(15-19)12-5-6-13-21)22-16-20(17-7-1-2-8-17)18-9-3-4-10-18/h17-20,22H,1-16H2 |
| InChIKey | NIKZYMOFRKRSET-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |