C11H16N4O4 — CID 167884886
N,3-dimethyl-2-oxo-N-[(2-oxo-3H-1,3,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide (PubChem CID 167884886) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is N,3-dimethyl-2-oxo-N-[(2-oxo-3H-1,3,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide.
| Compound Name | N,3-dimethyl-2-oxo-N-[(2-oxo-3H-1,3,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 167884886 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N,3-dimethyl-2-oxo-N-[(2-oxo-3H-1,3,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide |
| SMILES | CN(Cc1n[nH]c(=O)o1)C(=O)C1(C)CCCNC1=O |
| InChI | InChI=1S/C11H16N4O4/c1-11(4-3-5-12-8(11)16)9(17)15(2)6-7-13-14-10(18)19-7/h3-6H2,1-2H3,(H,12,16)(H,14,18) |
| InChIKey | IZGNYLDKUDQQLR-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|