About 2-N-[6-(3,5-difluorophenoxy)-3-pyridinyl]thiophene-2,5-dicarboxamide
2-N-[6-(3,5-difluorophenoxy)-3-pyridinyl]thiophene-2,5-dicarboxamide (PubChem CID 167885546) has the molecular formula C17H11F2N3O3S
and a molecular weight of 375.36 g/mol. Its IUPAC name is 2-N-[6-(3,5-difluorophenoxy)-3-pyridinyl]thiophene-2,5-dicarboxamide.
Molecular Properties
| Compound Name | 2-N-[6-(3,5-difluorophenoxy)-3-pyridinyl]thiophene-2,5-dicarboxamide |
| PubChem CID | 167885546 |
| Molecular Formula | C17H11F2N3O3S |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 2-N-[6-(3,5-difluorophenoxy)-3-pyridinyl]thiophene-2,5-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)Nc2ccc(Oc3cc(F)cc(F)c3)nc2)s1 |
| InChI | InChI=1S/C17H11F2N3O3S/c18-9-5-10(19)7-12(6-9)25-15-4-1-11(8-21-15)22-17(24)14-3-2-13(26-14)16(20)23/h1-8H,(H2,20,23)(H,22,24) |
| InChIKey | FUFDXNBANNXDTR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N-[6-(3,5-difluorophenoxy)-3-pyridinyl]thiophene-2,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[6-(3,5-difluorophenoxy)-3-pyridinyl]thiophene-2,5-dicarboxamide?
The IUPAC name of 2-N-[6-(3,5-difluorophenoxy)-3-pyridinyl]thiophene-2,5-dicarboxamide (CID 167885546) is 2-N-[6-(3,5-difluorophenoxy)-3-pyridinyl]thiophene-2,5-dicarboxamide.
What is the SMILES notation for 2-N-[6-(3,5-difluorophenoxy)-3-pyridinyl]thiophene-2,5-dicarboxamide?
The canonical SMILES for 2-N-[6-(3,5-difluorophenoxy)-3-pyridinyl]thiophene-2,5-dicarboxamide is NC(=O)c1ccc(C(=O)Nc2ccc(Oc3cc(F)cc(F)c3)nc2)s1.
What is the InChIKey of 2-N-[6-(3,5-difluorophenoxy)-3-pyridinyl]thiophene-2,5-dicarboxamide?
The InChIKey is FUFDXNBANNXDTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F2N3O3S/c18-9-5-10(19)7-12(6-9)25-15-4-1-11(8-21-15)22-17(24)14-3-2-13(26-14)16(20)23/h1-8H,(H2,20,23)(H,22,24).
What are the key properties of 2-N-[6-(3,5-difluorophenoxy)-3-pyridinyl]thiophene-2,5-dicarboxamide?
2-N-[6-(3,5-difluorophenoxy)-3-pyridinyl]thiophene-2,5-dicarboxamide has a molecular weight of 375.36 g/mol, XLogP of 3.56, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[6-(3,5-difluorophenoxy)-3-pyridinyl]thiophene-2,5-dicarboxamide is sourced from PubChem (CID 167885546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).