C15H16N4O3S — CID 167885761
6-[5-(1H-pyrazol-5-yl)thiophene-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 167885761) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is 6-[5-(1H-pyrazol-5-yl)thiophene-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | 6-[5-(1H-pyrazol-5-yl)thiophene-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 167885761 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 6-[5-(1H-pyrazol-5-yl)thiophene-2-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | O=C1COC2CCN(C(=O)c3ccc(-c4ccn[nH]4)s3)CC2N1 |
| InChI | InChI=1S/C15H16N4O3S/c20-14-8-22-11-4-6-19(7-10(11)17-14)15(21)13-2-1-12(23-13)9-3-5-16-18-9/h1-3,5,10-11H,4,6-8H2,(H,16,18)(H,17,20) |
| InChIKey | VFOSUJUYYKUFJT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |