About 5-(4-phenylphenyl)imidazolidine-2,4-dione
5-(4-phenylphenyl)imidazolidine-2,4-dione (PubChem CID 16788632) has the molecular formula C15H12N2O2
and a molecular weight of 252.27 g/mol. Its IUPAC name is 5-(4-phenylphenyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(4-phenylphenyl)imidazolidine-2,4-dione |
| PubChem CID | 16788632 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 5-(4-phenylphenyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2ccc(-c3ccccc3)cc2)N1 |
| InChI | InChI=1S/C15H12N2O2/c18-14-13(16-15(19)17-14)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,13H,(H2,16,17,18,19) |
| InChIKey | VEAQTEDCTWELRX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-phenylphenyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-phenylphenyl)imidazolidine-2,4-dione?
The IUPAC name of 5-(4-phenylphenyl)imidazolidine-2,4-dione (CID 16788632) is 5-(4-phenylphenyl)imidazolidine-2,4-dione.
What is the SMILES notation for 5-(4-phenylphenyl)imidazolidine-2,4-dione?
The canonical SMILES for 5-(4-phenylphenyl)imidazolidine-2,4-dione is O=C1NC(=O)C(c2ccc(-c3ccccc3)cc2)N1.
What is the InChIKey of 5-(4-phenylphenyl)imidazolidine-2,4-dione?
The InChIKey is VEAQTEDCTWELRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2/c18-14-13(16-15(19)17-14)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,13H,(H2,16,17,18,19).
What are the key properties of 5-(4-phenylphenyl)imidazolidine-2,4-dione?
5-(4-phenylphenyl)imidazolidine-2,4-dione has a molecular weight of 252.27 g/mol, XLogP of 2.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-phenylphenyl)imidazolidine-2,4-dione is sourced from PubChem (CID 16788632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).