About 1-[2-[(1,1-dioxothian-3-yl)methoxy]-6-(trifluoromethyl)-3-pyridinyl]ethanone
1-[2-[(1,1-dioxothian-3-yl)methoxy]-6-(trifluoromethyl)-3-pyridinyl]ethanone (PubChem CID 167886751) has the molecular formula C14H16F3NO4S
and a molecular weight of 351.35 g/mol. Its IUPAC name is 1-[2-[(1,1-dioxothian-3-yl)methoxy]-6-(trifluoromethyl)-3-pyridinyl]ethanone.
Molecular Properties
| Compound Name | 1-[2-[(1,1-dioxothian-3-yl)methoxy]-6-(trifluoromethyl)-3-pyridinyl]ethanone |
| PubChem CID | 167886751 |
| Molecular Formula | C14H16F3NO4S |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-[2-[(1,1-dioxothian-3-yl)methoxy]-6-(trifluoromethyl)-3-pyridinyl]ethanone |
| SMILES | CC(=O)c1ccc(C(F)(F)F)nc1OCC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16F3NO4S/c1-9(19)11-4-5-12(14(15,16)17)18-13(11)22-7-10-3-2-6-23(20,21)8-10/h4-5,10H,2-3,6-8H2,1H3 |
| InChIKey | GXLWBDPSUUPDRA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[(1,1-dioxothian-3-yl)methoxy]-6-(trifluoromethyl)-3-pyridinyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(1,1-dioxothian-3-yl)methoxy]-6-(trifluoromethyl)-3-pyridinyl]ethanone?
The IUPAC name of 1-[2-[(1,1-dioxothian-3-yl)methoxy]-6-(trifluoromethyl)-3-pyridinyl]ethanone (CID 167886751) is 1-[2-[(1,1-dioxothian-3-yl)methoxy]-6-(trifluoromethyl)-3-pyridinyl]ethanone.
What is the SMILES notation for 1-[2-[(1,1-dioxothian-3-yl)methoxy]-6-(trifluoromethyl)-3-pyridinyl]ethanone?
The canonical SMILES for 1-[2-[(1,1-dioxothian-3-yl)methoxy]-6-(trifluoromethyl)-3-pyridinyl]ethanone is CC(=O)c1ccc(C(F)(F)F)nc1OCC1CCCS(=O)(=O)C1.
What is the InChIKey of 1-[2-[(1,1-dioxothian-3-yl)methoxy]-6-(trifluoromethyl)-3-pyridinyl]ethanone?
The InChIKey is GXLWBDPSUUPDRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F3NO4S/c1-9(19)11-4-5-12(14(15,16)17)18-13(11)22-7-10-3-2-6-23(20,21)8-10/h4-5,10H,2-3,6-8H2,1H3.
What are the key properties of 1-[2-[(1,1-dioxothian-3-yl)methoxy]-6-(trifluoromethyl)-3-pyridinyl]ethanone?
1-[2-[(1,1-dioxothian-3-yl)methoxy]-6-(trifluoromethyl)-3-pyridinyl]ethanone has a molecular weight of 351.35 g/mol, XLogP of 2.51, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(1,1-dioxothian-3-yl)methoxy]-6-(trifluoromethyl)-3-pyridinyl]ethanone is sourced from PubChem (CID 167886751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).