About 3-[(8-methyl-1,5-naphthyridin-4-yl)oxy]propan-1-ol
3-[(8-methyl-1,5-naphthyridin-4-yl)oxy]propan-1-ol (PubChem CID 167887918) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-[(8-methyl-1,5-naphthyridin-4-yl)oxy]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(8-methyl-1,5-naphthyridin-4-yl)oxy]propan-1-ol |
| PubChem CID | 167887918 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-[(8-methyl-1,5-naphthyridin-4-yl)oxy]propan-1-ol |
| SMILES | Cc1ccnc2c(OCCCO)ccnc12 |
| InChI | InChI=1S/C12H14N2O2/c1-9-3-5-14-12-10(16-8-2-7-15)4-6-13-11(9)12/h3-6,15H,2,7-8H2,1H3 |
| InChIKey | ORQOQHJCUQEASY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(8-methyl-1,5-naphthyridin-4-yl)oxy]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(8-methyl-1,5-naphthyridin-4-yl)oxy]propan-1-ol?
The IUPAC name of 3-[(8-methyl-1,5-naphthyridin-4-yl)oxy]propan-1-ol (CID 167887918) is 3-[(8-methyl-1,5-naphthyridin-4-yl)oxy]propan-1-ol.
What is the SMILES notation for 3-[(8-methyl-1,5-naphthyridin-4-yl)oxy]propan-1-ol?
The canonical SMILES for 3-[(8-methyl-1,5-naphthyridin-4-yl)oxy]propan-1-ol is Cc1ccnc2c(OCCCO)ccnc12.
What is the InChIKey of 3-[(8-methyl-1,5-naphthyridin-4-yl)oxy]propan-1-ol?
The InChIKey is ORQOQHJCUQEASY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-9-3-5-14-12-10(16-8-2-7-15)4-6-13-11(9)12/h3-6,15H,2,7-8H2,1H3.
What are the key properties of 3-[(8-methyl-1,5-naphthyridin-4-yl)oxy]propan-1-ol?
3-[(8-methyl-1,5-naphthyridin-4-yl)oxy]propan-1-ol has a molecular weight of 218.26 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(8-methyl-1,5-naphthyridin-4-yl)oxy]propan-1-ol is sourced from PubChem (CID 167887918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).