About 4-[2-[(3-ethylcyclopentyl)amino]ethyl]-3,5-difluorophenol
4-[2-[(3-ethylcyclopentyl)amino]ethyl]-3,5-difluorophenol (PubChem CID 167888620) has the molecular formula C15H21F2NO
and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-[2-[(3-ethylcyclopentyl)amino]ethyl]-3,5-difluorophenol.
Molecular Properties
| Compound Name | 4-[2-[(3-ethylcyclopentyl)amino]ethyl]-3,5-difluorophenol |
| PubChem CID | 167888620 |
| Molecular Formula | C15H21F2NO |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 4-[2-[(3-ethylcyclopentyl)amino]ethyl]-3,5-difluorophenol |
| SMILES | CCC1CCC(NCCc2c(F)cc(O)cc2F)C1 |
| InChI | InChI=1S/C15H21F2NO/c1-2-10-3-4-11(7-10)18-6-5-13-14(16)8-12(19)9-15(13)17/h8-11,18-19H,2-7H2,1H3 |
| InChIKey | UMNIJMVBZCZXJQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[2-[(3-ethylcyclopentyl)amino]ethyl]-3,5-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(3-ethylcyclopentyl)amino]ethyl]-3,5-difluorophenol?
The IUPAC name of 4-[2-[(3-ethylcyclopentyl)amino]ethyl]-3,5-difluorophenol (CID 167888620) is 4-[2-[(3-ethylcyclopentyl)amino]ethyl]-3,5-difluorophenol.
What is the SMILES notation for 4-[2-[(3-ethylcyclopentyl)amino]ethyl]-3,5-difluorophenol?
The canonical SMILES for 4-[2-[(3-ethylcyclopentyl)amino]ethyl]-3,5-difluorophenol is CCC1CCC(NCCc2c(F)cc(O)cc2F)C1.
What is the InChIKey of 4-[2-[(3-ethylcyclopentyl)amino]ethyl]-3,5-difluorophenol?
The InChIKey is UMNIJMVBZCZXJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F2NO/c1-2-10-3-4-11(7-10)18-6-5-13-14(16)8-12(19)9-15(13)17/h8-11,18-19H,2-7H2,1H3.
What are the key properties of 4-[2-[(3-ethylcyclopentyl)amino]ethyl]-3,5-difluorophenol?
4-[2-[(3-ethylcyclopentyl)amino]ethyl]-3,5-difluorophenol has a molecular weight of 269.33 g/mol, XLogP of 3.38, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(3-ethylcyclopentyl)amino]ethyl]-3,5-difluorophenol is sourced from PubChem (CID 167888620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).