About 4-(6,7-dichloroquinoxalin-2-yl)-3-ethylpiperazin-2-one
4-(6,7-dichloroquinoxalin-2-yl)-3-ethylpiperazin-2-one (PubChem CID 167888729) has the molecular formula C14H14Cl2N4O
and a molecular weight of 325.20 g/mol. Its IUPAC name is 4-(6,7-dichloroquinoxalin-2-yl)-3-ethylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-(6,7-dichloroquinoxalin-2-yl)-3-ethylpiperazin-2-one |
| PubChem CID | 167888729 |
| Molecular Formula | C14H14Cl2N4O |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 4-(6,7-dichloroquinoxalin-2-yl)-3-ethylpiperazin-2-one |
| SMILES | CCC1C(=O)NCCN1c1cnc2cc(Cl)c(Cl)cc2n1 |
| InChI | InChI=1S/C14H14Cl2N4O/c1-2-12-14(21)17-3-4-20(12)13-7-18-10-5-8(15)9(16)6-11(10)19-13/h5-7,12H,2-4H2,1H3,(H,17,21) |
| InChIKey | FHHYPJSFDKOGDU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(6,7-dichloroquinoxalin-2-yl)-3-ethylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6,7-dichloroquinoxalin-2-yl)-3-ethylpiperazin-2-one?
The IUPAC name of 4-(6,7-dichloroquinoxalin-2-yl)-3-ethylpiperazin-2-one (CID 167888729) is 4-(6,7-dichloroquinoxalin-2-yl)-3-ethylpiperazin-2-one.
What is the SMILES notation for 4-(6,7-dichloroquinoxalin-2-yl)-3-ethylpiperazin-2-one?
The canonical SMILES for 4-(6,7-dichloroquinoxalin-2-yl)-3-ethylpiperazin-2-one is CCC1C(=O)NCCN1c1cnc2cc(Cl)c(Cl)cc2n1.
What is the InChIKey of 4-(6,7-dichloroquinoxalin-2-yl)-3-ethylpiperazin-2-one?
The InChIKey is FHHYPJSFDKOGDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N4O/c1-2-12-14(21)17-3-4-20(12)13-7-18-10-5-8(15)9(16)6-11(10)19-13/h5-7,12H,2-4H2,1H3,(H,17,21).
What are the key properties of 4-(6,7-dichloroquinoxalin-2-yl)-3-ethylpiperazin-2-one?
4-(6,7-dichloroquinoxalin-2-yl)-3-ethylpiperazin-2-one has a molecular weight of 325.20 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6,7-dichloroquinoxalin-2-yl)-3-ethylpiperazin-2-one is sourced from PubChem (CID 167888729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).