C15H16FN3O2 — CID 167888932
(3aS,7aS)-3a-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole (PubChem CID 167888932) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is (3aS,7aS)-3a-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole.
| Compound Name | (3aS,7aS)-3a-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole |
|---|---|
| PubChem CID | 167888932 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (3aS,7aS)-3a-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-2,3,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole |
| SMILES | Fc1ccccc1-c1noc([C@]23CNC[C@H]2CCOC3)n1 |
| InChI | InChI=1S/C15H16FN3O2/c16-12-4-2-1-3-11(12)13-18-14(21-19-13)15-8-17-7-10(15)5-6-20-9-15/h1-4,10,17H,5-9H2/t10-,15+/m1/s1 |
| InChIKey | DRIFOFLJTNBGNY-BMIGLBTASA-N |
| XLogP | 1.75 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |