C16H19N3O3 — CID 167890277
2-N-[4-(2-oxopyrrolidin-1-yl)phenyl]cyclobutane-1,2-dicarboxamide (PubChem CID 167890277) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-N-[4-(2-oxopyrrolidin-1-yl)phenyl]cyclobutane-1,2-dicarboxamide.
| Compound Name | 2-N-[4-(2-oxopyrrolidin-1-yl)phenyl]cyclobutane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 167890277 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-N-[4-(2-oxopyrrolidin-1-yl)phenyl]cyclobutane-1,2-dicarboxamide |
| SMILES | NC(=O)C1CCC1C(=O)Nc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C16H19N3O3/c17-15(21)12-7-8-13(12)16(22)18-10-3-5-11(6-4-10)19-9-1-2-14(19)20/h3-6,12-13H,1-2,7-9H2,(H2,17,21)(H,18,22) |
| InChIKey | JUEHJEOOHHLZSQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |