About 2-(3-methyltriazol-4-yl)ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate
2-(3-methyltriazol-4-yl)ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 167890316) has the molecular formula C14H14N6O4
and a molecular weight of 330.30 g/mol. Its IUPAC name is 2-(3-methyltriazol-4-yl)ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | 2-(3-methyltriazol-4-yl)ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate |
| PubChem CID | 167890316 |
| Molecular Formula | C14H14N6O4 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2-(3-methyltriazol-4-yl)ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | Cn1nncc1CCOC(=O)c1cnc2c(c1)c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H14N6O4/c1-19-11-10(12(21)17-14(19)23)5-8(6-15-11)13(22)24-4-3-9-7-16-18-20(9)2/h5-7H,3-4H2,1-2H3,(H,17,21,23) |
| InChIKey | DDUNKRZVZSXXRM-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-(3-methyltriazol-4-yl)ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyltriazol-4-yl)ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate?
The IUPAC name of 2-(3-methyltriazol-4-yl)ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate (CID 167890316) is 2-(3-methyltriazol-4-yl)ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate.
What is the SMILES notation for 2-(3-methyltriazol-4-yl)ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate?
The canonical SMILES for 2-(3-methyltriazol-4-yl)ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate is Cn1nncc1CCOC(=O)c1cnc2c(c1)c(=O)[nH]c(=O)n2C.
What is the InChIKey of 2-(3-methyltriazol-4-yl)ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate?
The InChIKey is DDUNKRZVZSXXRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N6O4/c1-19-11-10(12(21)17-14(19)23)5-8(6-15-11)13(22)24-4-3-9-7-16-18-20(9)2/h5-7H,3-4H2,1-2H3,(H,17,21,23).
What are the key properties of 2-(3-methyltriazol-4-yl)ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate?
2-(3-methyltriazol-4-yl)ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate has a molecular weight of 330.30 g/mol, XLogP of -0.85, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyltriazol-4-yl)ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate is sourced from PubChem (CID 167890316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).