C26H20BrClN4O4 — CID 167890331
N-[3-(5-bromopyrimidin-2-yl)oxyphenyl]-N'-[(4-chlorophenyl)-(4-methoxyphenyl)methyl]oxamide (PubChem CID 167890331) has the molecular formula C26H20BrClN4O4 and a molecular weight of 567.83 g/mol. Its IUPAC name is N-[3-(5-bromopyrimidin-2-yl)oxyphenyl]-N'-[(4-chlorophenyl)-(4-methoxyphenyl)methyl]oxamide.
| Compound Name | N-[3-(5-bromopyrimidin-2-yl)oxyphenyl]-N'-[(4-chlorophenyl)-(4-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 167890331 |
| Molecular Formula | C26H20BrClN4O4 |
| Molecular Weight | 567.83 g/mol |
| Exact Mass | 566.04 |
| IUPAC Name | N-[3-(5-bromopyrimidin-2-yl)oxyphenyl]-N'-[(4-chlorophenyl)-(4-methoxyphenyl)methyl]oxamide |
| SMILES | COc1ccc(C(NC(=O)C(=O)Nc2cccc(Oc3ncc(Br)cn3)c2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H20BrClN4O4/c1-35-21-11-7-17(8-12-21)23(16-5-9-19(28)10-6-16)32-25(34)24(33)31-20-3-2-4-22(13-20)36-26-29-14-18(27)15-30-26/h2-15,23H,1H3,(H,31,33)(H,32,34) |
| InChIKey | NWZXMXNQYWPPPU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.83 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|