C14H12F2N2O — CID 16789035
N-(5-amino-2-fluorophenyl)-2-(4-fluorophenyl)acetamide (PubChem CID 16789035) has the molecular formula C14H12F2N2O and a molecular weight of 262.26 g/mol. Its IUPAC name is N-(5-amino-2-fluorophenyl)-2-(4-fluorophenyl)acetamide.
| Compound Name | N-(5-amino-2-fluorophenyl)-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 16789035 |
| Molecular Formula | C14H12F2N2O |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | N-(5-amino-2-fluorophenyl)-2-(4-fluorophenyl)acetamide |
| SMILES | Nc1ccc(F)c(NC(=O)Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C14H12F2N2O/c15-10-3-1-9(2-4-10)7-14(19)18-13-8-11(17)5-6-12(13)16/h1-6,8H,7,17H2,(H,18,19) |
| InChIKey | WGJWLCRDNVJKPM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|