About N-[4-fluoro-3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-(2-oxo-1H-quinolin-3-yl)acetamide
N-[4-fluoro-3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-(2-oxo-1H-quinolin-3-yl)acetamide (PubChem CID 167890984) has the molecular formula C21H19FN4O3
and a molecular weight of 394.41 g/mol. Its IUPAC name is N-[4-fluoro-3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-(2-oxo-1H-quinolin-3-yl)acetamide.
Molecular Properties
| Compound Name | N-[4-fluoro-3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-(2-oxo-1H-quinolin-3-yl)acetamide |
| PubChem CID | 167890984 |
| Molecular Formula | C21H19FN4O3 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[4-fluoro-3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-(2-oxo-1H-quinolin-3-yl)acetamide |
| SMILES | O=C(Cc1cc2ccccc2[nH]c1=O)Nc1ccc(F)c(N2CCCNC2=O)c1 |
| InChI | InChI=1S/C21H19FN4O3/c22-16-7-6-15(12-18(16)26-9-3-8-23-21(26)29)24-19(27)11-14-10-13-4-1-2-5-17(13)25-20(14)28/h1-2,4-7,10,12H,3,8-9,11H2,(H,23,29)(H,24,27)(H,25,28) |
| InChIKey | JOESIKONXLZETQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-fluoro-3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-(2-oxo-1H-quinolin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-fluoro-3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-(2-oxo-1H-quinolin-3-yl)acetamide?
The IUPAC name of N-[4-fluoro-3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-(2-oxo-1H-quinolin-3-yl)acetamide (CID 167890984) is N-[4-fluoro-3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-(2-oxo-1H-quinolin-3-yl)acetamide.
What is the SMILES notation for N-[4-fluoro-3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-(2-oxo-1H-quinolin-3-yl)acetamide?
The canonical SMILES for N-[4-fluoro-3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-(2-oxo-1H-quinolin-3-yl)acetamide is O=C(Cc1cc2ccccc2[nH]c1=O)Nc1ccc(F)c(N2CCCNC2=O)c1.
What is the InChIKey of N-[4-fluoro-3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-(2-oxo-1H-quinolin-3-yl)acetamide?
The InChIKey is JOESIKONXLZETQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FN4O3/c22-16-7-6-15(12-18(16)26-9-3-8-23-21(26)29)24-19(27)11-14-10-13-4-1-2-5-17(13)25-20(14)28/h1-2,4-7,10,12H,3,8-9,11H2,(H,23,29)(H,24,27)(H,25,28).
What are the key properties of N-[4-fluoro-3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-(2-oxo-1H-quinolin-3-yl)acetamide?
N-[4-fluoro-3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-(2-oxo-1H-quinolin-3-yl)acetamide has a molecular weight of 394.41 g/mol, XLogP of 2.77, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-fluoro-3-(2-oxo-1,3-diazinan-1-yl)phenyl]-2-(2-oxo-1H-quinolin-3-yl)acetamide is sourced from PubChem (CID 167890984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).