C22H30N4O2 — CID 167891982
N-[2-cyclopropyl-2-[[(1R,2S,4R,5S)-tricyclo[3.2.1.02,4]octane-3-carbonyl]amino]ethyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 167891982) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[2-cyclopropyl-2-[[(1R,2S,4R,5S)-tricyclo[3.2.1.02,4]octane-3-carbonyl]amino]ethyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[2-cyclopropyl-2-[[(1R,2S,4R,5S)-tricyclo[3.2.1.02,4]octane-3-carbonyl]amino]ethyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 167891982 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-[2-cyclopropyl-2-[[(1R,2S,4R,5S)-tricyclo[3.2.1.02,4]octane-3-carbonyl]amino]ethyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | O=C(NCC(NC(=O)C1[C@@H]2[C@H]3CC[C@H](C3)[C@H]12)C1CC1)c1n[nH]c2c1CCCC2 |
| InChI | InChI=1S/C22H30N4O2/c27-21(19-17-12-7-8-13(9-12)18(17)19)24-16(11-5-6-11)10-23-22(28)20-14-3-1-2-4-15(14)25-26-20/h11-13,16-19H,1-10H2,(H,23,28)(H,24,27)(H,25,26)/t12-,13+,16?,17+,18-,19? |
| InChIKey | LOCPGEYBXMXIMF-NXSKZJCUSA-N |
| XLogP | 2.21 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |