C24H32N4O4S — CID 167891994
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-N'-[1-[3-(dimethylsulfamoyl)phenyl]ethyl]oxamide (PubChem CID 167891994) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-N'-[1-[3-(dimethylsulfamoyl)phenyl]ethyl]oxamide.
| Compound Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-N'-[1-[3-(dimethylsulfamoyl)phenyl]ethyl]oxamide |
|---|---|
| PubChem CID | 167891994 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-N'-[1-[3-(dimethylsulfamoyl)phenyl]ethyl]oxamide |
| SMILES | CC(NC(=O)C(=O)NCC(C)N1CCc2ccccc2C1)c1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C24H32N4O4S/c1-17(28-13-12-19-8-5-6-9-21(19)16-28)15-25-23(29)24(30)26-18(2)20-10-7-11-22(14-20)33(31,32)27(3)4/h5-11,14,17-18H,12-13,15-16H2,1-4H3,(H,25,29)(H,26,30) |
| InChIKey | RXMHFBUJEGZIBV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|