About 2-chloro-N-[[1-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-N-(4-ethynylphenyl)acetamide
2-chloro-N-[[1-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-N-(4-ethynylphenyl)acetamide (PubChem CID 167892227) has the molecular formula C16H14ClF2N3O
and a molecular weight of 337.76 g/mol. Its IUPAC name is 2-chloro-N-[[1-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-N-(4-ethynylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-[[1-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-N-(4-ethynylphenyl)acetamide |
| PubChem CID | 167892227 |
| Molecular Formula | C16H14ClF2N3O |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-chloro-N-[[1-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-N-(4-ethynylphenyl)acetamide |
| SMILES | C#Cc1ccc(N(Cc2ccn(CC(F)F)n2)C(=O)CCl)cc1 |
| InChI | InChI=1S/C16H14ClF2N3O/c1-2-12-3-5-14(6-4-12)22(16(23)9-17)10-13-7-8-21(20-13)11-15(18)19/h1,3-8,15H,9-11H2 |
| InChIKey | BNJXUWOFDATMEK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[[1-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-N-(4-ethynylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[[1-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-N-(4-ethynylphenyl)acetamide?
The IUPAC name of 2-chloro-N-[[1-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-N-(4-ethynylphenyl)acetamide (CID 167892227) is 2-chloro-N-[[1-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-N-(4-ethynylphenyl)acetamide.
What is the SMILES notation for 2-chloro-N-[[1-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-N-(4-ethynylphenyl)acetamide?
The canonical SMILES for 2-chloro-N-[[1-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-N-(4-ethynylphenyl)acetamide is C#Cc1ccc(N(Cc2ccn(CC(F)F)n2)C(=O)CCl)cc1.
What is the InChIKey of 2-chloro-N-[[1-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-N-(4-ethynylphenyl)acetamide?
The InChIKey is BNJXUWOFDATMEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClF2N3O/c1-2-12-3-5-14(6-4-12)22(16(23)9-17)10-13-7-8-21(20-13)11-15(18)19/h1,3-8,15H,9-11H2.
What are the key properties of 2-chloro-N-[[1-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-N-(4-ethynylphenyl)acetamide?
2-chloro-N-[[1-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-N-(4-ethynylphenyl)acetamide has a molecular weight of 337.76 g/mol, XLogP of 2.90, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[[1-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-N-(4-ethynylphenyl)acetamide is sourced from PubChem (CID 167892227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).