About 3-[2-(4-nitrophenoxy)ethoxy]-[1,2,4]triazolo[4,3-a]pyridine
3-[2-(4-nitrophenoxy)ethoxy]-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 167893657) has the molecular formula C14H12N4O4
and a molecular weight of 300.27 g/mol. Its IUPAC name is 3-[2-(4-nitrophenoxy)ethoxy]-[1,2,4]triazolo[4,3-a]pyridine.
Molecular Properties
| Compound Name | 3-[2-(4-nitrophenoxy)ethoxy]-[1,2,4]triazolo[4,3-a]pyridine |
| PubChem CID | 167893657 |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 3-[2-(4-nitrophenoxy)ethoxy]-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | O=[N+]([O-])c1ccc(OCCOc2nnc3ccccn23)cc1 |
| InChI | InChI=1S/C14H12N4O4/c19-18(20)11-4-6-12(7-5-11)21-9-10-22-14-16-15-13-3-1-2-8-17(13)14/h1-8H,9-10H2 |
| InChIKey | IOXCFXSGHNQKDB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(4-nitrophenoxy)ethoxy]-[1,2,4]triazolo[4,3-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-nitrophenoxy)ethoxy]-[1,2,4]triazolo[4,3-a]pyridine?
The IUPAC name of 3-[2-(4-nitrophenoxy)ethoxy]-[1,2,4]triazolo[4,3-a]pyridine (CID 167893657) is 3-[2-(4-nitrophenoxy)ethoxy]-[1,2,4]triazolo[4,3-a]pyridine.
What is the SMILES notation for 3-[2-(4-nitrophenoxy)ethoxy]-[1,2,4]triazolo[4,3-a]pyridine?
The canonical SMILES for 3-[2-(4-nitrophenoxy)ethoxy]-[1,2,4]triazolo[4,3-a]pyridine is O=[N+]([O-])c1ccc(OCCOc2nnc3ccccn23)cc1.
What is the InChIKey of 3-[2-(4-nitrophenoxy)ethoxy]-[1,2,4]triazolo[4,3-a]pyridine?
The InChIKey is IOXCFXSGHNQKDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O4/c19-18(20)11-4-6-12(7-5-11)21-9-10-22-14-16-15-13-3-1-2-8-17(13)14/h1-8H,9-10H2.
What are the key properties of 3-[2-(4-nitrophenoxy)ethoxy]-[1,2,4]triazolo[4,3-a]pyridine?
3-[2-(4-nitrophenoxy)ethoxy]-[1,2,4]triazolo[4,3-a]pyridine has a molecular weight of 300.27 g/mol, XLogP of 2.10, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-nitrophenoxy)ethoxy]-[1,2,4]triazolo[4,3-a]pyridine is sourced from PubChem (CID 167893657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).