About 2-(3,4-dihydro-1H-isochromen-7-yl)-3-methylimidazo[4,5-c]pyridine
2-(3,4-dihydro-1H-isochromen-7-yl)-3-methylimidazo[4,5-c]pyridine (PubChem CID 167893785) has the molecular formula C16H15N3O
and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isochromen-7-yl)-3-methylimidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 2-(3,4-dihydro-1H-isochromen-7-yl)-3-methylimidazo[4,5-c]pyridine |
| PubChem CID | 167893785 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-(3,4-dihydro-1H-isochromen-7-yl)-3-methylimidazo[4,5-c]pyridine |
| SMILES | Cn1c(-c2ccc3c(c2)COCC3)nc2ccncc21 |
| InChI | InChI=1S/C16H15N3O/c1-19-15-9-17-6-4-14(15)18-16(19)12-3-2-11-5-7-20-10-13(11)8-12/h2-4,6,8-9H,5,7,10H2,1H3 |
| InChIKey | KFDNVBMDMGOHMN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dihydro-1H-isochromen-7-yl)-3-methylimidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-1H-isochromen-7-yl)-3-methylimidazo[4,5-c]pyridine?
The IUPAC name of 2-(3,4-dihydro-1H-isochromen-7-yl)-3-methylimidazo[4,5-c]pyridine (CID 167893785) is 2-(3,4-dihydro-1H-isochromen-7-yl)-3-methylimidazo[4,5-c]pyridine.
What is the SMILES notation for 2-(3,4-dihydro-1H-isochromen-7-yl)-3-methylimidazo[4,5-c]pyridine?
The canonical SMILES for 2-(3,4-dihydro-1H-isochromen-7-yl)-3-methylimidazo[4,5-c]pyridine is Cn1c(-c2ccc3c(c2)COCC3)nc2ccncc21.
What is the InChIKey of 2-(3,4-dihydro-1H-isochromen-7-yl)-3-methylimidazo[4,5-c]pyridine?
The InChIKey is KFDNVBMDMGOHMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O/c1-19-15-9-17-6-4-14(15)18-16(19)12-3-2-11-5-7-20-10-13(11)8-12/h2-4,6,8-9H,5,7,10H2,1H3.
What are the key properties of 2-(3,4-dihydro-1H-isochromen-7-yl)-3-methylimidazo[4,5-c]pyridine?
2-(3,4-dihydro-1H-isochromen-7-yl)-3-methylimidazo[4,5-c]pyridine has a molecular weight of 265.32 g/mol, XLogP of 2.71, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-1H-isochromen-7-yl)-3-methylimidazo[4,5-c]pyridine is sourced from PubChem (CID 167893785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).