C18H19N5O — CID 167894941
(3-benzylpiperazin-1-yl)-(1H-imidazo[4,5-b]pyridin-7-yl)methanone (PubChem CID 167894941) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is (3-benzylpiperazin-1-yl)-(1H-imidazo[4,5-b]pyridin-7-yl)methanone.
| Compound Name | (3-benzylpiperazin-1-yl)-(1H-imidazo[4,5-b]pyridin-7-yl)methanone |
|---|---|
| PubChem CID | 167894941 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (3-benzylpiperazin-1-yl)-(1H-imidazo[4,5-b]pyridin-7-yl)methanone |
| SMILES | O=C(c1ccnc2nc[nH]c12)N1CCNC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H19N5O/c24-18(15-6-7-20-17-16(15)21-12-22-17)23-9-8-19-14(11-23)10-13-4-2-1-3-5-13/h1-7,12,14,19H,8-11H2,(H,20,21,22) |
| InChIKey | LEDSXNSWRARLNB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |