C20H26N2O3 — CID 167895166
N-[(3-hydroxy-1-tricyclo[2.2.1.02,6]heptanyl)methyl]-6,6-dimethyl-2-oxo-1,5,7,8-tetrahydroquinoline-3-carboxamide (PubChem CID 167895166) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[(3-hydroxy-1-tricyclo[2.2.1.02,6]heptanyl)methyl]-6,6-dimethyl-2-oxo-1,5,7,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-[(3-hydroxy-1-tricyclo[2.2.1.02,6]heptanyl)methyl]-6,6-dimethyl-2-oxo-1,5,7,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 167895166 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[(3-hydroxy-1-tricyclo[2.2.1.02,6]heptanyl)methyl]-6,6-dimethyl-2-oxo-1,5,7,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CC1(C)CCc2[nH]c(=O)c(C(=O)NCC34CC5CC3C4C5O)cc2C1 |
| InChI | InChI=1S/C20H26N2O3/c1-19(2)4-3-14-10(7-19)5-12(18(25)22-14)17(24)21-9-20-8-11-6-13(20)15(20)16(11)23/h5,11,13,15-16,23H,3-4,6-9H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | FDCOJICIAGLLAM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |