C13H15BrN2O2 — CID 167896042
3-[(6-bromo-1H-indol-2-yl)methylamino]butanoic acid (PubChem CID 167896042) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is 3-[(6-bromo-1H-indol-2-yl)methylamino]butanoic acid.
| Compound Name | 3-[(6-bromo-1H-indol-2-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 167896042 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 3-[(6-bromo-1H-indol-2-yl)methylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NCc1cc2ccc(Br)cc2[nH]1 |
| InChI | InChI=1S/C13H15BrN2O2/c1-8(4-13(17)18)15-7-11-5-9-2-3-10(14)6-12(9)16-11/h2-3,5-6,8,15-16H,4,7H2,1H3,(H,17,18) |
| InChIKey | ACLRBRVLEPAYTP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |