C19H27N3O3 — CID 167896398
2-[[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]amino]-3-[benzyl(methyl)amino]propanoic acid (PubChem CID 167896398) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-[[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]amino]-3-[benzyl(methyl)amino]propanoic acid.
| Compound Name | 2-[[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]amino]-3-[benzyl(methyl)amino]propanoic acid |
|---|---|
| PubChem CID | 167896398 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 2-[[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]amino]-3-[benzyl(methyl)amino]propanoic acid |
| SMILES | CN(Cc1ccccc1)CC(NC(=O)N1C[C@H]2CCC[C@H]2C1)C(=O)O |
| InChI | InChI=1S/C19H27N3O3/c1-21(10-14-6-3-2-4-7-14)13-17(18(23)24)20-19(25)22-11-15-8-5-9-16(15)12-22/h2-4,6-7,15-17H,5,8-13H2,1H3,(H,20,25)(H,23,24)/t15-,16+,17? |
| InChIKey | BLOWCFIEMFXFDI-SJPCQFCGSA-N |
| XLogP | 2.01 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |