About 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-amine
2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-amine (PubChem CID 16789654) has the molecular formula C10H16N2S
and a molecular weight of 196.32 g/mol. Its IUPAC name is 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-amine.
Molecular Properties
| Compound Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-amine |
| PubChem CID | 16789654 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-amine |
| SMILES | CC(CN)N1CCc2sccc2C1 |
| InChI | InChI=1S/C10H16N2S/c1-8(6-11)12-4-2-10-9(7-12)3-5-13-10/h3,5,8H,2,4,6-7,11H2,1H3 |
| InChIKey | MQKOIUAPLLHABT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-amine?
The IUPAC name of 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-amine (CID 16789654) is 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-amine.
What is the SMILES notation for 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-amine?
The canonical SMILES for 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-amine is CC(CN)N1CCc2sccc2C1.
What is the InChIKey of 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-amine?
The InChIKey is MQKOIUAPLLHABT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2S/c1-8(6-11)12-4-2-10-9(7-12)3-5-13-10/h3,5,8H,2,4,6-7,11H2,1H3.
What are the key properties of 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-amine?
2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-amine has a molecular weight of 196.32 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-amine is sourced from PubChem (CID 16789654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).