C17H20N2O3 — CID 167898298
4-cyclopropyl-N-[(3S,4R)-3,4-dihydroxycyclopentyl]-1H-indole-2-carboxamide (PubChem CID 167898298) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-cyclopropyl-N-[(3S,4R)-3,4-dihydroxycyclopentyl]-1H-indole-2-carboxamide.
| Compound Name | 4-cyclopropyl-N-[(3S,4R)-3,4-dihydroxycyclopentyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167898298 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 4-cyclopropyl-N-[(3S,4R)-3,4-dihydroxycyclopentyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NC1C[C@@H](O)[C@@H](O)C1)c1cc2c(C3CC3)cccc2[nH]1 |
| InChI | InChI=1S/C17H20N2O3/c20-15-6-10(7-16(15)21)18-17(22)14-8-12-11(9-4-5-9)2-1-3-13(12)19-14/h1-3,8-10,15-16,19-21H,4-7H2,(H,18,22)/t10?,15-,16+ |
| InChIKey | HIHMGIXNECHLQB-QEPHCTRTSA-N |
| XLogP | 1.66 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |