C21H21FN4O3S — CID 167899209
7-[2-(1-aminoethyl)morpholine-4-carbonyl]-3-(2-fluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 167899209) has the molecular formula C21H21FN4O3S and a molecular weight of 428.49 g/mol. Its IUPAC name is 7-[2-(1-aminoethyl)morpholine-4-carbonyl]-3-(2-fluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 7-[2-(1-aminoethyl)morpholine-4-carbonyl]-3-(2-fluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 167899209 |
| Molecular Formula | C21H21FN4O3S |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 7-[2-(1-aminoethyl)morpholine-4-carbonyl]-3-(2-fluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | CC(N)C1CN(C(=O)c2ccc3c(=O)n(-c4ccccc4F)c(=S)[nH]c3c2)CCO1 |
| InChI | InChI=1S/C21H21FN4O3S/c1-12(23)18-11-25(8-9-29-18)19(27)13-6-7-14-16(10-13)24-21(30)26(20(14)28)17-5-3-2-4-15(17)22/h2-7,10,12,18H,8-9,11,23H2,1H3,(H,24,30) |
| InChIKey | QOVJMJBZAWQBNS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|