C30H28Cl3N3O4 — CID 167900240
N-[3-chloro-4-(morpholine-4-carbonyl)phenyl]-N'-[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N'-methyloxamide (PubChem CID 167900240) has the molecular formula C30H28Cl3N3O4 and a molecular weight of 600.93 g/mol. Its IUPAC name is N-[3-chloro-4-(morpholine-4-carbonyl)phenyl]-N'-[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N'-methyloxamide.
| Compound Name | N-[3-chloro-4-(morpholine-4-carbonyl)phenyl]-N'-[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N'-methyloxamide |
|---|---|
| PubChem CID | 167900240 |
| Molecular Formula | C30H28Cl3N3O4 |
| Molecular Weight | 600.93 g/mol |
| Exact Mass | 599.11 |
| IUPAC Name | N-[3-chloro-4-(morpholine-4-carbonyl)phenyl]-N'-[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N'-methyloxamide |
| SMILES | CN(C(=O)C(=O)Nc1ccc(C(=O)N2CCOCC2)c(Cl)c1)[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C30H28Cl3N3O4/c1-35(27-11-9-20(21-4-2-3-5-22(21)27)18-6-10-24(31)26(33)16-18)30(39)28(37)34-19-7-8-23(25(32)17-19)29(38)36-12-14-40-15-13-36/h2-8,10,16-17,20,27H,9,11-15H2,1H3,(H,34,37)/t20-,27-/m0/s1 |
| InChIKey | LPRYFADRMWEVMQ-DCFHFQCYSA-N |
| XLogP | 6.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.93 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|