About 6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioamide
6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioamide (PubChem CID 16790119) has the molecular formula C7H7N3S2
and a molecular weight of 197.29 g/mol. Its IUPAC name is 6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioamide.
Molecular Properties
| Compound Name | 6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioamide |
| PubChem CID | 16790119 |
| Molecular Formula | C7H7N3S2 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioamide |
| SMILES | Cc1nc2sccn2c1C(N)=S |
| InChI | InChI=1S/C7H7N3S2/c1-4-5(6(8)11)10-2-3-12-7(10)9-4/h2-3H,1H3,(H2,8,11) |
| InChIKey | VGDQUXAYRAZUGT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioamide?
The IUPAC name of 6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioamide (CID 16790119) is 6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioamide.
What is the SMILES notation for 6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioamide?
The canonical SMILES for 6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioamide is Cc1nc2sccn2c1C(N)=S.
What is the InChIKey of 6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioamide?
The InChIKey is VGDQUXAYRAZUGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S2/c1-4-5(6(8)11)10-2-3-12-7(10)9-4/h2-3H,1H3,(H2,8,11).
What are the key properties of 6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioamide?
6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioamide has a molecular weight of 197.29 g/mol, XLogP of 1.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioamide is sourced from PubChem (CID 16790119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).