About (3-methylsulfanylcyclohexyl) 4H-imidazo[5,1-c][1,4]benzoxazine-3-carboxylate
(3-methylsulfanylcyclohexyl) 4H-imidazo[5,1-c][1,4]benzoxazine-3-carboxylate (PubChem CID 167901264) has the molecular formula C18H20N2O3S
and a molecular weight of 344.44 g/mol. Its IUPAC name is (3-methylsulfanylcyclohexyl) 4H-imidazo[5,1-c][1,4]benzoxazine-3-carboxylate.
Molecular Properties
| Compound Name | (3-methylsulfanylcyclohexyl) 4H-imidazo[5,1-c][1,4]benzoxazine-3-carboxylate |
| PubChem CID | 167901264 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (3-methylsulfanylcyclohexyl) 4H-imidazo[5,1-c][1,4]benzoxazine-3-carboxylate |
| SMILES | CSC1CCCC(OC(=O)c2ncn3c2COc2ccccc2-3)C1 |
| InChI | InChI=1S/C18H20N2O3S/c1-24-13-6-4-5-12(9-13)23-18(21)17-15-10-22-16-8-3-2-7-14(16)20(15)11-19-17/h2-3,7-8,11-13H,4-6,9-10H2,1H3 |
| InChIKey | QLJDNZYTTITVML-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-methylsulfanylcyclohexyl) 4H-imidazo[5,1-c][1,4]benzoxazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylsulfanylcyclohexyl) 4H-imidazo[5,1-c][1,4]benzoxazine-3-carboxylate?
The IUPAC name of (3-methylsulfanylcyclohexyl) 4H-imidazo[5,1-c][1,4]benzoxazine-3-carboxylate (CID 167901264) is (3-methylsulfanylcyclohexyl) 4H-imidazo[5,1-c][1,4]benzoxazine-3-carboxylate.
What is the SMILES notation for (3-methylsulfanylcyclohexyl) 4H-imidazo[5,1-c][1,4]benzoxazine-3-carboxylate?
The canonical SMILES for (3-methylsulfanylcyclohexyl) 4H-imidazo[5,1-c][1,4]benzoxazine-3-carboxylate is CSC1CCCC(OC(=O)c2ncn3c2COc2ccccc2-3)C1.
What is the InChIKey of (3-methylsulfanylcyclohexyl) 4H-imidazo[5,1-c][1,4]benzoxazine-3-carboxylate?
The InChIKey is QLJDNZYTTITVML-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O3S/c1-24-13-6-4-5-12(9-13)23-18(21)17-15-10-22-16-8-3-2-7-14(16)20(15)11-19-17/h2-3,7-8,11-13H,4-6,9-10H2,1H3.
What are the key properties of (3-methylsulfanylcyclohexyl) 4H-imidazo[5,1-c][1,4]benzoxazine-3-carboxylate?
(3-methylsulfanylcyclohexyl) 4H-imidazo[5,1-c][1,4]benzoxazine-3-carboxylate has a molecular weight of 344.44 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylsulfanylcyclohexyl) 4H-imidazo[5,1-c][1,4]benzoxazine-3-carboxylate is sourced from PubChem (CID 167901264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).