C17H11N5O4S — CID 167901360
4-nitro-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,1,3-benzothiadiazole-6-carboxamide (PubChem CID 167901360) has the molecular formula C17H11N5O4S and a molecular weight of 381.37 g/mol. Its IUPAC name is 4-nitro-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,1,3-benzothiadiazole-6-carboxamide.
| Compound Name | 4-nitro-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,1,3-benzothiadiazole-6-carboxamide |
|---|---|
| PubChem CID | 167901360 |
| Molecular Formula | C17H11N5O4S |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 4-nitro-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2,1,3-benzothiadiazole-6-carboxamide |
| SMILES | O=C(NCc1cc(-c2ccccc2)on1)c1cc([N+](=O)[O-])c2nsnc2c1 |
| InChI | InChI=1S/C17H11N5O4S/c23-17(11-6-13-16(21-27-20-13)14(7-11)22(24)25)18-9-12-8-15(26-19-12)10-4-2-1-3-5-10/h1-8H,9H2,(H,18,23) |
| InChIKey | CJMDWWNILWGFGN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|