C13H14N4O4 — CID 16790154
N-(4-amino-2-methoxyphenyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide (PubChem CID 16790154) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is N-(4-amino-2-methoxyphenyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide.
| Compound Name | N-(4-amino-2-methoxyphenyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide |
|---|---|
| PubChem CID | 16790154 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | N-(4-amino-2-methoxyphenyl)-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide |
| SMILES | COc1cc(N)ccc1NC(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C13H14N4O4/c1-21-10-6-8(14)2-3-9(10)15-12(19)7-17-13(20)5-4-11(18)16-17/h2-6H,7,14H2,1H3,(H,15,19)(H,16,18) |
| InChIKey | BMBXTHQLRCQFTE-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|