About 1-[[1-(1,3-benzothiazol-6-yl)triazol-4-yl]methyl]-5-hydroxypiperidin-2-one
1-[[1-(1,3-benzothiazol-6-yl)triazol-4-yl]methyl]-5-hydroxypiperidin-2-one (PubChem CID 167901987) has the molecular formula C15H15N5O2S
and a molecular weight of 329.39 g/mol. Its IUPAC name is 1-[[1-(1,3-benzothiazol-6-yl)triazol-4-yl]methyl]-5-hydroxypiperidin-2-one.
Molecular Properties
| Compound Name | 1-[[1-(1,3-benzothiazol-6-yl)triazol-4-yl]methyl]-5-hydroxypiperidin-2-one |
| PubChem CID | 167901987 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 1-[[1-(1,3-benzothiazol-6-yl)triazol-4-yl]methyl]-5-hydroxypiperidin-2-one |
| SMILES | O=C1CCC(O)CN1Cc1cn(-c2ccc3ncsc3c2)nn1 |
| InChI | InChI=1S/C15H15N5O2S/c21-12-2-4-15(22)19(8-12)6-10-7-20(18-17-10)11-1-3-13-14(5-11)23-9-16-13/h1,3,5,7,9,12,21H,2,4,6,8H2 |
| InChIKey | LKMSNJRMWSYXPC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[[1-(1,3-benzothiazol-6-yl)triazol-4-yl]methyl]-5-hydroxypiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-(1,3-benzothiazol-6-yl)triazol-4-yl]methyl]-5-hydroxypiperidin-2-one?
The IUPAC name of 1-[[1-(1,3-benzothiazol-6-yl)triazol-4-yl]methyl]-5-hydroxypiperidin-2-one (CID 167901987) is 1-[[1-(1,3-benzothiazol-6-yl)triazol-4-yl]methyl]-5-hydroxypiperidin-2-one.
What is the SMILES notation for 1-[[1-(1,3-benzothiazol-6-yl)triazol-4-yl]methyl]-5-hydroxypiperidin-2-one?
The canonical SMILES for 1-[[1-(1,3-benzothiazol-6-yl)triazol-4-yl]methyl]-5-hydroxypiperidin-2-one is O=C1CCC(O)CN1Cc1cn(-c2ccc3ncsc3c2)nn1.
What is the InChIKey of 1-[[1-(1,3-benzothiazol-6-yl)triazol-4-yl]methyl]-5-hydroxypiperidin-2-one?
The InChIKey is LKMSNJRMWSYXPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5O2S/c21-12-2-4-15(22)19(8-12)6-10-7-20(18-17-10)11-1-3-13-14(5-11)23-9-16-13/h1,3,5,7,9,12,21H,2,4,6,8H2.
What are the key properties of 1-[[1-(1,3-benzothiazol-6-yl)triazol-4-yl]methyl]-5-hydroxypiperidin-2-one?
1-[[1-(1,3-benzothiazol-6-yl)triazol-4-yl]methyl]-5-hydroxypiperidin-2-one has a molecular weight of 329.39 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-(1,3-benzothiazol-6-yl)triazol-4-yl]methyl]-5-hydroxypiperidin-2-one is sourced from PubChem (CID 167901987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).