C17H21FN4O2 — CID 167902752
3-[5-(2-cyclopentyl-1-fluoroethyl)-1,2,4-oxadiazol-3-yl]-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one (PubChem CID 167902752) has the molecular formula C17H21FN4O2 and a molecular weight of 332.38 g/mol. Its IUPAC name is 3-[5-(2-cyclopentyl-1-fluoroethyl)-1,2,4-oxadiazol-3-yl]-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one.
| Compound Name | 3-[5-(2-cyclopentyl-1-fluoroethyl)-1,2,4-oxadiazol-3-yl]-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 167902752 |
| Molecular Formula | C17H21FN4O2 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3-[5-(2-cyclopentyl-1-fluoroethyl)-1,2,4-oxadiazol-3-yl]-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-2-one |
| SMILES | O=c1[nH]c2c(cc1-c1noc(C(F)CC3CCCC3)n1)CNCC2 |
| InChI | InChI=1S/C17H21FN4O2/c18-13(7-10-3-1-2-4-10)17-21-15(22-24-17)12-8-11-9-19-6-5-14(11)20-16(12)23/h8,10,13,19H,1-7,9H2,(H,20,23) |
| InChIKey | SRAXFOMATJCFQZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |