C11H13FN2 — CID 167902971
2-fluoro-5-(1,2,3,6-tetrahydropyridin-5-yl)aniline (PubChem CID 167902971) has the molecular formula C11H13FN2 and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-fluoro-5-(1,2,3,6-tetrahydropyridin-5-yl)aniline.
| Compound Name | 2-fluoro-5-(1,2,3,6-tetrahydropyridin-5-yl)aniline |
|---|---|
| PubChem CID | 167902971 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 2-fluoro-5-(1,2,3,6-tetrahydropyridin-5-yl)aniline |
| SMILES | Nc1cc(C2=CCCNC2)ccc1F |
| InChI | InChI=1S/C11H13FN2/c12-10-4-3-8(6-11(10)13)9-2-1-5-14-7-9/h2-4,6,14H,1,5,7,13H2 |
| InChIKey | PATPSGVGAQBUDP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|