C13H10F5N3 — CID 167903059
2-(1,1,2,2,2-pentafluoroethyl)-N-(pyrazin-2-ylmethyl)aniline (PubChem CID 167903059) has the molecular formula C13H10F5N3 and a molecular weight of 303.23 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)-N-(pyrazin-2-ylmethyl)aniline.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)-N-(pyrazin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 167903059 |
| Molecular Formula | C13H10F5N3 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)-N-(pyrazin-2-ylmethyl)aniline |
| SMILES | FC(F)(F)C(F)(F)c1ccccc1NCc1cnccn1 |
| InChI | InChI=1S/C13H10F5N3/c14-12(15,13(16,17)18)10-3-1-2-4-11(10)21-8-9-7-19-5-6-20-9/h1-7,21H,8H2 |
| InChIKey | PHJMWXNZFGDJRV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|