C17H21N3O2S — CID 167903682
3-(3-but-3-ynyldiazirin-3-yl)-N-[(4-methyl-6,7-dihydrothieno[3,2-c]pyran-4-yl)methyl]propanamide (PubChem CID 167903682) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-[(4-methyl-6,7-dihydrothieno[3,2-c]pyran-4-yl)methyl]propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[(4-methyl-6,7-dihydrothieno[3,2-c]pyran-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 167903682 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[(4-methyl-6,7-dihydrothieno[3,2-c]pyran-4-yl)methyl]propanamide |
| SMILES | C#CCCC1(CCC(=O)NCC2(C)OCCc3sccc32)N=N1 |
| InChI | InChI=1S/C17H21N3O2S/c1-3-4-8-17(19-20-17)9-5-15(21)18-12-16(2)13-7-11-23-14(13)6-10-22-16/h1,7,11H,4-6,8-10,12H2,2H3,(H,18,21) |
| InChIKey | BBUYXHHAZSNLME-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|