C18H23FN4O — CID 167905137
(4-fluorophenyl)-[1-[(1-propan-2-ylpiperidin-2-yl)methyl]triazol-4-yl]methanone (PubChem CID 167905137) has the molecular formula C18H23FN4O and a molecular weight of 330.41 g/mol. Its IUPAC name is (4-fluorophenyl)-[1-[(1-propan-2-ylpiperidin-2-yl)methyl]triazol-4-yl]methanone.
| Compound Name | (4-fluorophenyl)-[1-[(1-propan-2-ylpiperidin-2-yl)methyl]triazol-4-yl]methanone |
|---|---|
| PubChem CID | 167905137 |
| Molecular Formula | C18H23FN4O |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (4-fluorophenyl)-[1-[(1-propan-2-ylpiperidin-2-yl)methyl]triazol-4-yl]methanone |
| SMILES | CC(C)N1CCCCC1Cn1cc(C(=O)c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C18H23FN4O/c1-13(2)23-10-4-3-5-16(23)11-22-12-17(20-21-22)18(24)14-6-8-15(19)9-7-14/h6-9,12-13,16H,3-5,10-11H2,1-2H3 |
| InChIKey | IADXHDZIMUUPSV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |