C18H13NOS — CID 167905585
(E)-1-(3-phenylphenyl)-3-(1,3-thiazol-5-yl)prop-2-en-1-one (PubChem CID 167905585) has the molecular formula C18H13NOS and a molecular weight of 291.38 g/mol. Its IUPAC name is (E)-1-(3-phenylphenyl)-3-(1,3-thiazol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(3-phenylphenyl)-3-(1,3-thiazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 167905585 |
| Molecular Formula | C18H13NOS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (E)-1-(3-phenylphenyl)-3-(1,3-thiazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cncs1)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H13NOS/c20-18(10-9-17-12-19-13-21-17)16-8-4-7-15(11-16)14-5-2-1-3-6-14/h1-13H/b10-9+ |
| InChIKey | IOYDUFBPEFAZOU-MDZDMXLPSA-N |
| XLogP | 4.71 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|