C24H21N3O3S — CID 167906615
N-[5-methyl-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1,3-thiazol-2-yl]-10-oxopentacyclo[5.3.0.02,5.03,9.04,8]decane-3-carboxamide (PubChem CID 167906615) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-[5-methyl-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1,3-thiazol-2-yl]-10-oxopentacyclo[5.3.0.02,5.03,9.04,8]decane-3-carboxamide.
| Compound Name | N-[5-methyl-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1,3-thiazol-2-yl]-10-oxopentacyclo[5.3.0.02,5.03,9.04,8]decane-3-carboxamide |
|---|---|
| PubChem CID | 167906615 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-[5-methyl-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1,3-thiazol-2-yl]-10-oxopentacyclo[5.3.0.02,5.03,9.04,8]decane-3-carboxamide |
| SMILES | Cc1sc(NC(=O)C23C4C(=O)C5C6CC(C52)C3C64)nc1-c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C24H21N3O3S/c1-8-20(10-2-4-13-9(6-10)3-5-14(28)25-13)26-23(31-8)27-22(30)24-17-12-7-11-15(17)19(24)21(29)16(11)18(12)24/h2,4,6,11-12,15-19H,3,5,7H2,1H3,(H,25,28)(H,26,27,30) |
| InChIKey | IMMYFZOMMFIGEH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |