C17H29N5O3 — CID 167906787
2-[1-[[1-[6-(dimethylamino)hexanoyl]pyrrolidin-3-yl]methyl]triazol-4-yl]acetic acid (PubChem CID 167906787) has the molecular formula C17H29N5O3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-[1-[[1-[6-(dimethylamino)hexanoyl]pyrrolidin-3-yl]methyl]triazol-4-yl]acetic acid.
| Compound Name | 2-[1-[[1-[6-(dimethylamino)hexanoyl]pyrrolidin-3-yl]methyl]triazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 167906787 |
| Molecular Formula | C17H29N5O3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 2-[1-[[1-[6-(dimethylamino)hexanoyl]pyrrolidin-3-yl]methyl]triazol-4-yl]acetic acid |
| SMILES | CN(C)CCCCCC(=O)N1CCC(Cn2cc(CC(=O)O)nn2)C1 |
| InChI | InChI=1S/C17H29N5O3/c1-20(2)8-5-3-4-6-16(23)21-9-7-14(11-21)12-22-13-15(18-19-22)10-17(24)25/h13-14H,3-12H2,1-2H3,(H,24,25) |
| InChIKey | XELTUQFVBSQAQU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|