About 1-(4-chlorophenyl)-N-[(3,3-difluorocyclobutyl)methyl]-5-methylpyrazole-3-carboxamide
1-(4-chlorophenyl)-N-[(3,3-difluorocyclobutyl)methyl]-5-methylpyrazole-3-carboxamide (PubChem CID 167906921) has the molecular formula C16H16ClF2N3O
and a molecular weight of 339.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(3,3-difluorocyclobutyl)methyl]-5-methylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-N-[(3,3-difluorocyclobutyl)methyl]-5-methylpyrazole-3-carboxamide |
| PubChem CID | 167906921 |
| Molecular Formula | C16H16ClF2N3O |
| Molecular Weight | 339.77 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(3,3-difluorocyclobutyl)methyl]-5-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC2CC(F)(F)C2)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16ClF2N3O/c1-10-6-14(15(23)20-9-11-7-16(18,19)8-11)21-22(10)13-4-2-12(17)3-5-13/h2-6,11H,7-9H2,1H3,(H,20,23) |
| InChIKey | YMMWBWOSUJMMLF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.77 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chlorophenyl)-N-[(3,3-difluorocyclobutyl)methyl]-5-methylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-N-[(3,3-difluorocyclobutyl)methyl]-5-methylpyrazole-3-carboxamide?
The IUPAC name of 1-(4-chlorophenyl)-N-[(3,3-difluorocyclobutyl)methyl]-5-methylpyrazole-3-carboxamide (CID 167906921) is 1-(4-chlorophenyl)-N-[(3,3-difluorocyclobutyl)methyl]-5-methylpyrazole-3-carboxamide.
What is the SMILES notation for 1-(4-chlorophenyl)-N-[(3,3-difluorocyclobutyl)methyl]-5-methylpyrazole-3-carboxamide?
The canonical SMILES for 1-(4-chlorophenyl)-N-[(3,3-difluorocyclobutyl)methyl]-5-methylpyrazole-3-carboxamide is Cc1cc(C(=O)NCC2CC(F)(F)C2)nn1-c1ccc(Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-N-[(3,3-difluorocyclobutyl)methyl]-5-methylpyrazole-3-carboxamide?
The InChIKey is YMMWBWOSUJMMLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClF2N3O/c1-10-6-14(15(23)20-9-11-7-16(18,19)8-11)21-22(10)13-4-2-12(17)3-5-13/h2-6,11H,7-9H2,1H3,(H,20,23).
What are the key properties of 1-(4-chlorophenyl)-N-[(3,3-difluorocyclobutyl)methyl]-5-methylpyrazole-3-carboxamide?
1-(4-chlorophenyl)-N-[(3,3-difluorocyclobutyl)methyl]-5-methylpyrazole-3-carboxamide has a molecular weight of 339.77 g/mol, XLogP of 3.61, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-N-[(3,3-difluorocyclobutyl)methyl]-5-methylpyrazole-3-carboxamide is sourced from PubChem (CID 167906921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).