About 4-[2-amino-2-(2,4,6-trimethylphenyl)ethyl]piperazin-2-one
4-[2-amino-2-(2,4,6-trimethylphenyl)ethyl]piperazin-2-one (PubChem CID 16790701) has the molecular formula C15H23N3O
and a molecular weight of 261.37 g/mol. Its IUPAC name is 4-[2-amino-2-(2,4,6-trimethylphenyl)ethyl]piperazin-2-one.
Molecular Properties
| Compound Name | 4-[2-amino-2-(2,4,6-trimethylphenyl)ethyl]piperazin-2-one |
| PubChem CID | 16790701 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 4-[2-amino-2-(2,4,6-trimethylphenyl)ethyl]piperazin-2-one |
| SMILES | Cc1cc(C)c(C(N)CN2CCNC(=O)C2)c(C)c1 |
| InChI | InChI=1S/C15H23N3O/c1-10-6-11(2)15(12(3)7-10)13(16)8-18-5-4-17-14(19)9-18/h6-7,13H,4-5,8-9,16H2,1-3H3,(H,17,19) |
| InChIKey | IZSBWPXBVWBPGY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-amino-2-(2,4,6-trimethylphenyl)ethyl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-amino-2-(2,4,6-trimethylphenyl)ethyl]piperazin-2-one?
The IUPAC name of 4-[2-amino-2-(2,4,6-trimethylphenyl)ethyl]piperazin-2-one (CID 16790701) is 4-[2-amino-2-(2,4,6-trimethylphenyl)ethyl]piperazin-2-one.
What is the SMILES notation for 4-[2-amino-2-(2,4,6-trimethylphenyl)ethyl]piperazin-2-one?
The canonical SMILES for 4-[2-amino-2-(2,4,6-trimethylphenyl)ethyl]piperazin-2-one is Cc1cc(C)c(C(N)CN2CCNC(=O)C2)c(C)c1.
What is the InChIKey of 4-[2-amino-2-(2,4,6-trimethylphenyl)ethyl]piperazin-2-one?
The InChIKey is IZSBWPXBVWBPGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O/c1-10-6-11(2)15(12(3)7-10)13(16)8-18-5-4-17-14(19)9-18/h6-7,13H,4-5,8-9,16H2,1-3H3,(H,17,19).
What are the key properties of 4-[2-amino-2-(2,4,6-trimethylphenyl)ethyl]piperazin-2-one?
4-[2-amino-2-(2,4,6-trimethylphenyl)ethyl]piperazin-2-one has a molecular weight of 261.37 g/mol, XLogP of 1.04, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-amino-2-(2,4,6-trimethylphenyl)ethyl]piperazin-2-one is sourced from PubChem (CID 16790701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).