C18H19N5OS — CID 167908396
5,6-dimethyl-2-(1,4,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-ylmethyl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 167908396) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is 5,6-dimethyl-2-(1,4,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-ylmethyl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5,6-dimethyl-2-(1,4,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-ylmethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 167908396 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 5,6-dimethyl-2-(1,4,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-ylmethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(CN3c4ccncc4N4CCC3C4)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C18H19N5OS/c1-10-11(2)25-18-16(10)17(24)20-15(21-18)9-23-12-4-6-22(8-12)14-7-19-5-3-13(14)23/h3,5,7,12H,4,6,8-9H2,1-2H3,(H,20,21,24) |
| InChIKey | RTMICQDINQYGDG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |