C14H18N6O4 — CID 167908488
2-[1-[6-(2-hydroxyethoxy)pyrazin-2-yl]piperidin-4-yl]triazole-4-carboxylic acid (PubChem CID 167908488) has the molecular formula C14H18N6O4 and a molecular weight of 334.34 g/mol. Its IUPAC name is 2-[1-[6-(2-hydroxyethoxy)pyrazin-2-yl]piperidin-4-yl]triazole-4-carboxylic acid.
| Compound Name | 2-[1-[6-(2-hydroxyethoxy)pyrazin-2-yl]piperidin-4-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 167908488 |
| Molecular Formula | C14H18N6O4 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-[1-[6-(2-hydroxyethoxy)pyrazin-2-yl]piperidin-4-yl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(C2CCN(c3cncc(OCCO)n3)CC2)n1 |
| InChI | InChI=1S/C14H18N6O4/c21-5-6-24-13-9-15-8-12(17-13)19-3-1-10(2-4-19)20-16-7-11(18-20)14(22)23/h7-10,21H,1-6H2,(H,22,23) |
| InChIKey | ZMFQZVHFXJWKRL-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |