C18H22N2O4S — CID 167908776
methyl 2-methyl-6-[methyl-[1-(4-methylsulfonylphenyl)ethyl]amino]pyridine-3-carboxylate (PubChem CID 167908776) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is methyl 2-methyl-6-[methyl-[1-(4-methylsulfonylphenyl)ethyl]amino]pyridine-3-carboxylate.
| Compound Name | methyl 2-methyl-6-[methyl-[1-(4-methylsulfonylphenyl)ethyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 167908776 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | methyl 2-methyl-6-[methyl-[1-(4-methylsulfonylphenyl)ethyl]amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N(C)C(C)c2ccc(S(C)(=O)=O)cc2)nc1C |
| InChI | InChI=1S/C18H22N2O4S/c1-12-16(18(21)24-4)10-11-17(19-12)20(3)13(2)14-6-8-15(9-7-14)25(5,22)23/h6-11,13H,1-5H3 |
| InChIKey | ZJCUVDMOAARBSQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |